About 3-tridecan-7-yl-1,2-oxazol-4-amine
3-tridecan-7-yl-1,2-oxazol-4-amine (PubChem CID 155010814) has the molecular formula C16H30N2O
and a molecular weight of 266.43 g/mol. Its IUPAC name is 3-tridecan-7-yl-1,2-oxazol-4-amine.
Molecular Properties
| Compound Name | 3-tridecan-7-yl-1,2-oxazol-4-amine |
| PubChem CID | 155010814 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 3-tridecan-7-yl-1,2-oxazol-4-amine |
| SMILES | CCCCCCC(CCCCCC)c1nocc1N |
| InChI | InChI=1S/C16H30N2O/c1-3-5-7-9-11-14(12-10-8-6-4-2)16-15(17)13-19-18-16/h13-14H,3-12,17H2,1-2H3 |
| InChIKey | VSWHJJFOIRKUFR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-tridecan-7-yl-1,2-oxazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tridecan-7-yl-1,2-oxazol-4-amine?
The IUPAC name of 3-tridecan-7-yl-1,2-oxazol-4-amine (CID 155010814) is 3-tridecan-7-yl-1,2-oxazol-4-amine.
What is the SMILES notation for 3-tridecan-7-yl-1,2-oxazol-4-amine?
The canonical SMILES for 3-tridecan-7-yl-1,2-oxazol-4-amine is CCCCCCC(CCCCCC)c1nocc1N.
What is the InChIKey of 3-tridecan-7-yl-1,2-oxazol-4-amine?
The InChIKey is VSWHJJFOIRKUFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O/c1-3-5-7-9-11-14(12-10-8-6-4-2)16-15(17)13-19-18-16/h13-14H,3-12,17H2,1-2H3.
What are the key properties of 3-tridecan-7-yl-1,2-oxazol-4-amine?
3-tridecan-7-yl-1,2-oxazol-4-amine has a molecular weight of 266.43 g/mol, XLogP of 5.28, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tridecan-7-yl-1,2-oxazol-4-amine is sourced from PubChem (CID 155010814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).