C16H30N2O — CID 129156165
2-tetradecan-7-yl-1,3,4-oxadiazole (PubChem CID 129156165) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-tetradecan-7-yl-1,3,4-oxadiazole.
| Compound Name | 2-tetradecan-7-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 129156165 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2-tetradecan-7-yl-1,3,4-oxadiazole |
| SMILES | CCCCCCCC(CCCCCC)c1nnco1 |
| InChI | InChI=1S/C16H30N2O/c1-3-5-7-9-11-13-15(12-10-8-6-4-2)16-18-17-14-19-16/h14-15H,3-13H2,1-2H3 |
| InChIKey | UKENSMAWNCZZKB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|