C15H27NS — CID 134557589
5-dodecan-6-yl-1,2-thiazole (PubChem CID 134557589) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is 5-dodecan-6-yl-1,2-thiazole.
| Compound Name | 5-dodecan-6-yl-1,2-thiazole |
|---|---|
| PubChem CID | 134557589 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 5-dodecan-6-yl-1,2-thiazole |
| SMILES | CCCCCCC(CCCCC)c1ccns1 |
| InChI | InChI=1S/C15H27NS/c1-3-5-7-9-11-14(10-8-6-4-2)15-12-13-16-17-15/h12-14H,3-11H2,1-2H3 |
| InChIKey | GFTSSVYGYYLKOL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|