C17H32N2S — CID 129212992
5-pentadecan-8-yl-1,2,4-thiadiazole (PubChem CID 129212992) has the molecular formula C17H32N2S and a molecular weight of 296.52 g/mol. Its IUPAC name is 5-pentadecan-8-yl-1,2,4-thiadiazole.
| Compound Name | 5-pentadecan-8-yl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 129212992 |
| Molecular Formula | C17H32N2S |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 5-pentadecan-8-yl-1,2,4-thiadiazole |
| SMILES | CCCCCCCC(CCCCCCC)c1ncns1 |
| InChI | InChI=1S/C17H32N2S/c1-3-5-7-9-11-13-16(17-18-15-19-20-17)14-12-10-8-6-4-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | SEOJITBGRPNVCV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|