C6H11N3S — CID 82415875
1-(1,2,4-thiadiazol-5-yl)butan-1-amine (PubChem CID 82415875) has the molecular formula C6H11N3S and a molecular weight of 157.24 g/mol. Its IUPAC name is 1-(1,2,4-thiadiazol-5-yl)butan-1-amine.
| Compound Name | 1-(1,2,4-thiadiazol-5-yl)butan-1-amine |
|---|---|
| PubChem CID | 82415875 |
| Molecular Formula | C6H11N3S |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 1-(1,2,4-thiadiazol-5-yl)butan-1-amine |
| SMILES | CCCC(N)c1ncns1 |
| InChI | InChI=1S/C6H11N3S/c1-2-3-5(7)6-8-4-9-10-6/h4-5H,2-3,7H2,1H3 |
| InChIKey | ZEBQVCPCSFZDCS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |