C6H11N3O — CID 93243184
(1R)-1-(1,2,4-oxadiazol-3-yl)butan-1-amine (PubChem CID 93243184) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is (1R)-1-(1,2,4-oxadiazol-3-yl)butan-1-amine.
| Compound Name | (1R)-1-(1,2,4-oxadiazol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 93243184 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | (1R)-1-(1,2,4-oxadiazol-3-yl)butan-1-amine |
| SMILES | CCC[C@@H](N)c1ncon1 |
| InChI | InChI=1S/C6H11N3O/c1-2-3-5(7)6-8-4-10-9-6/h4-5H,2-3,7H2,1H3/t5-/m1/s1 |
| InChIKey | MRULVSYBCCMCJK-RXMQYKEDSA-N |
| XLogP | 0.87 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |