C14H27N3O — CID 65428528
1-(5-octyl-1,2,4-oxadiazol-3-yl)butan-1-amine (PubChem CID 65428528) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-(5-octyl-1,2,4-oxadiazol-3-yl)butan-1-amine.
| Compound Name | 1-(5-octyl-1,2,4-oxadiazol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 65428528 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 1-(5-octyl-1,2,4-oxadiazol-3-yl)butan-1-amine |
| SMILES | CCCCCCCCc1nc(C(N)CCC)no1 |
| InChI | InChI=1S/C14H27N3O/c1-3-5-6-7-8-9-11-13-16-14(17-18-13)12(15)10-4-2/h12H,3-11,15H2,1-2H3 |
| InChIKey | UVKLVVRZICVRCU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|