About 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol
1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol (PubChem CID 102660835) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol.
Molecular Properties
| Compound Name | 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol |
| PubChem CID | 102660835 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol |
| SMILES | CCCCCCCCc1nc(C(C)O)no1 |
| InChI | InChI=1S/C12H22N2O2/c1-3-4-5-6-7-8-9-11-13-12(10(2)15)14-16-11/h10,15H,3-9H2,1-2H3 |
| InChIKey | PYDBCJVDWMAKNA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol?
The IUPAC name of 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol (CID 102660835) is 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol.
What is the SMILES notation for 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol?
The canonical SMILES for 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol is CCCCCCCCc1nc(C(C)O)no1.
What is the InChIKey of 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol?
The InChIKey is PYDBCJVDWMAKNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-3-4-5-6-7-8-9-11-13-12(10(2)15)14-16-11/h10,15H,3-9H2,1-2H3.
What are the key properties of 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol?
1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol has a molecular weight of 226.32 g/mol, XLogP of 3.03, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol is sourced from PubChem (CID 102660835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).