C12H22N2O2 — CID 102660835
1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol (PubChem CID 102660835) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol.
| Compound Name | 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 102660835 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-(5-octyl-1,2,4-oxadiazol-3-yl)ethanol |
| SMILES | CCCCCCCCc1nc(C(C)O)no1 |
| InChI | InChI=1S/C12H22N2O2/c1-3-4-5-6-7-8-9-11-13-12(10(2)15)14-16-11/h10,15H,3-9H2,1-2H3 |
| InChIKey | PYDBCJVDWMAKNA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|