C10H16N2O3 — CID 63448668
5-heptyl-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 63448668) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 5-heptyl-1,2,4-oxadiazole-3-carboxylic acid.
| Compound Name | 5-heptyl-1,2,4-oxadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 63448668 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 5-heptyl-1,2,4-oxadiazole-3-carboxylic acid |
| SMILES | CCCCCCCc1nc(C(=O)O)no1 |
| InChI | InChI=1S/C10H16N2O3/c1-2-3-4-5-6-7-8-11-9(10(13)14)12-15-8/h2-7H2,1H3,(H,13,14) |
| InChIKey | ZZEFGYIYPLMGJT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|