C8H13N3O3 — CID 112631792
5-(4-aminopentyl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 112631792) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 5-(4-aminopentyl)-1,2,4-oxadiazole-3-carboxylic acid.
| Compound Name | 5-(4-aminopentyl)-1,2,4-oxadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 112631792 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 5-(4-aminopentyl)-1,2,4-oxadiazole-3-carboxylic acid |
| SMILES | CC(N)CCCc1nc(C(=O)O)no1 |
| InChI | InChI=1S/C8H13N3O3/c1-5(9)3-2-4-6-10-7(8(12)13)11-14-6/h5H,2-4,9H2,1H3,(H,12,13) |
| InChIKey | PDBXJIUHUIHUPQ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |