C7H10N2O4 — CID 63382755
5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 63382755) has the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. Its IUPAC name is 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid.
| Compound Name | 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 63382755 |
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid |
| SMILES | CCOCCc1nc(C(=O)O)no1 |
| InChI | InChI=1S/C7H10N2O4/c1-2-12-4-3-5-8-6(7(10)11)9-13-5/h2-4H2,1H3,(H,10,11) |
| InChIKey | YYDSNWHVCKRTKV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|