5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid

C7H10N2O4 — CID 63382755

IUPAC5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid
SMILESCCOCCc1nc(C(=O)O)no1
InChIInChI=1S/C7H10N2O4/c1-2-12-4-3-5-8-6(7(10)11)9-13-5/h2-4H2,1H3,(H,10,11)
InChIKeyYYDSNWHVCKRTKV-UHFFFAOYSA-N
MW186.17 g/mol
LogP0.35
Rot. Bonds5

About 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid

5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 63382755) has the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. Its IUPAC name is 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid
PubChem CID63382755
Molecular FormulaC7H10N2O4
Molecular Weight186.17 g/mol
Exact Mass186.06
IUPAC Name5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid
SMILESCCOCCc1nc(C(=O)O)no1
InChIInChI=1S/C7H10N2O4/c1-2-12-4-3-5-8-6(7(10)11)9-13-5/h2-4H2,1H3,(H,10,11)
InChIKeyYYDSNWHVCKRTKV-UHFFFAOYSA-N
XLogP0.35
TPSA85.45 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.17
LogP ≤ 50.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid?
The IUPAC name of 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid (CID 63382755) is 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid.
What is the SMILES notation for 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid?
The canonical SMILES for 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid is CCOCCc1nc(C(=O)O)no1.
What is the InChIKey of 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid?
The InChIKey is YYDSNWHVCKRTKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4/c1-2-12-4-3-5-8-6(7(10)11)9-13-5/h2-4H2,1H3,(H,10,11).
What are the key properties of 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid?
5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid has a molecular weight of 186.17 g/mol, XLogP of 0.35, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-ethoxyethyl)-1,2,4-oxadiazole-3-carboxylic acid is sourced from PubChem (CID 63382755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).