C13H14N2O4 — CID 63379365
ethyl 5-(2-phenoxyethyl)-1,2,4-oxadiazole-3-carboxylate (PubChem CID 63379365) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is ethyl 5-(2-phenoxyethyl)-1,2,4-oxadiazole-3-carboxylate.
| Compound Name | ethyl 5-(2-phenoxyethyl)-1,2,4-oxadiazole-3-carboxylate |
|---|---|
| PubChem CID | 63379365 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | ethyl 5-(2-phenoxyethyl)-1,2,4-oxadiazole-3-carboxylate |
| SMILES | CCOC(=O)c1noc(CCOc2ccccc2)n1 |
| InChI | InChI=1S/C13H14N2O4/c1-2-17-13(16)12-14-11(19-15-12)8-9-18-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | QJNMBEZOSJSPPE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |