C16H15N3O2 — CID 43525276
3-[5-(2-phenoxyethyl)-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 43525276) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 3-[5-(2-phenoxyethyl)-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 3-[5-(2-phenoxyethyl)-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 43525276 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-[5-(2-phenoxyethyl)-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | Nc1cccc(-c2noc(CCOc3ccccc3)n2)c1 |
| InChI | InChI=1S/C16H15N3O2/c17-13-6-4-5-12(11-13)16-18-15(21-19-16)9-10-20-14-7-2-1-3-8-14/h1-8,11H,9-10,17H2 |
| InChIKey | XCUALHUYEQYYMW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|