C15H13N3O — CID 43525256
3-(5-benzyl-1,2,4-oxadiazol-3-yl)aniline (PubChem CID 43525256) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-(5-benzyl-1,2,4-oxadiazol-3-yl)aniline.
| Compound Name | 3-(5-benzyl-1,2,4-oxadiazol-3-yl)aniline |
|---|---|
| PubChem CID | 43525256 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 3-(5-benzyl-1,2,4-oxadiazol-3-yl)aniline |
| SMILES | Nc1cccc(-c2noc(Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C15H13N3O/c16-13-8-4-7-12(10-13)15-17-14(19-18-15)9-11-5-2-1-3-6-11/h1-8,10H,9,16H2 |
| InChIKey | XYSOTJOTSNCAGA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|