C21H17N3O2 — CID 23008157
3-[3-(4-phenylmethoxyphenyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 23008157) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 3-[3-(4-phenylmethoxyphenyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 3-[3-(4-phenylmethoxyphenyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 23008157 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 3-[3-(4-phenylmethoxyphenyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1cccc(-c2nc(-c3ccc(OCc4ccccc4)cc3)no2)c1 |
| InChI | InChI=1S/C21H17N3O2/c22-18-8-4-7-17(13-18)21-23-20(24-26-21)16-9-11-19(12-10-16)25-14-15-5-2-1-3-6-15/h1-13H,14,22H2 |
| InChIKey | VKGZAGLEDHGBGF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|