C18H19N3O3 — CID 42281999
3-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 42281999) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 3-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 42281999 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | CCOc1ccc(-c2nc(-c3cccc(N)c3)no2)cc1OCC |
| InChI | InChI=1S/C18H19N3O3/c1-3-22-15-9-8-13(11-16(15)23-4-2)18-20-17(21-24-18)12-6-5-7-14(19)10-12/h5-11H,3-4,19H2,1-2H3 |
| InChIKey | NYJNMVLRZQZQDW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|