C18H17FN2O3 — CID 159007615
5-[3-ethoxy-4-(2-(18F)fluoroethoxy)phenyl]-3-phenyl-1,2,4-oxadiazole (PubChem CID 159007615) has the molecular formula C18H17FN2O3 and a molecular weight of 327.35 g/mol. Its IUPAC name is 5-[3-ethoxy-4-(2-(18F)fluoroethoxy)phenyl]-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-[3-ethoxy-4-(2-(18F)fluoroethoxy)phenyl]-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 159007615 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 5-[3-ethoxy-4-(2-(18F)fluoroethoxy)phenyl]-3-phenyl-1,2,4-oxadiazole |
| SMILES | CCOc1cc(-c2nc(-c3ccccc3)no2)ccc1OCC[18F] |
| InChI | InChI=1S/C18H17FN2O3/c1-2-22-16-12-14(8-9-15(16)23-11-10-19)18-20-17(21-24-18)13-6-4-3-5-7-13/h3-9,12H,2,10-11H2,1H3/i19-1 |
| InChIKey | RFEWPVMGZIECFZ-AWDFDDCISA-N |
| XLogP | 4.15 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |