About 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid
5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 55252728) has the molecular formula C5H7N3O3
and a molecular weight of 157.13 g/mol. Its IUPAC name is 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid.
Analyze 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid?
The IUPAC name of 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid (CID 55252728) is 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid.
What is the SMILES notation for 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid?
The canonical SMILES for 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid is CNCc1nc(C(=O)O)no1.
What is the InChIKey of 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid?
The InChIKey is LJALKXVBONUZPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O3/c1-6-2-3-7-4(5(9)10)8-11-3/h6H,2H2,1H3,(H,9,10).
What are the key properties of 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid?
5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid has a molecular weight of 157.13 g/mol, XLogP of -0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxylic acid is sourced from PubChem (CID 55252728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).