About 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide
5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide (PubChem CID 102790320) has the molecular formula C5H8N4O2
and a molecular weight of 156.15 g/mol. Its IUPAC name is 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide.
Analyze 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide?
The IUPAC name of 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide (CID 102790320) is 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide.
What is the SMILES notation for 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide?
The canonical SMILES for 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide is CNCc1nc(C(N)=O)no1.
What is the InChIKey of 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide?
The InChIKey is WMXAQAPDGNVWAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2/c1-7-2-3-8-5(4(6)10)9-11-3/h7H,2H2,1H3,(H2,6,10).
What are the key properties of 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide?
5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide has a molecular weight of 156.15 g/mol, XLogP of -1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methylaminomethyl)-1,2,4-oxadiazole-3-carboxamide is sourced from PubChem (CID 102790320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).