C8H14N4O2 — CID 102790253
5-[2-(aminomethyl)butyl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 102790253) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 5-[2-(aminomethyl)butyl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-[2-(aminomethyl)butyl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 102790253 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 5-[2-(aminomethyl)butyl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CCC(CN)Cc1nc(C(N)=O)no1 |
| InChI | InChI=1S/C8H14N4O2/c1-2-5(4-9)3-6-11-8(7(10)13)12-14-6/h5H,2-4,9H2,1H3,(H2,10,13) |
| InChIKey | QLJWOTYDSCENKD-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |