C7H8N4O2 — CID 102790166
5-[(prop-2-ynylamino)methyl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 102790166) has the molecular formula C7H8N4O2 and a molecular weight of 180.17 g/mol. Its IUPAC name is 5-[(prop-2-ynylamino)methyl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-[(prop-2-ynylamino)methyl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 102790166 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 5-[(prop-2-ynylamino)methyl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | C#CCNCc1nc(C(N)=O)no1 |
| InChI | InChI=1S/C7H8N4O2/c1-2-3-9-4-5-10-7(6(8)12)11-13-5/h1,9H,3-4H2,(H2,8,12) |
| InChIKey | GIMHVUAKOXEYTD-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|