About 5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid
5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 63382576) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid.
Analyze 5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid?
The IUPAC name of 5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid (CID 63382576) is 5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid.
What is the SMILES notation for 5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid?
The canonical SMILES for 5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid is O=C(O)c1noc(CC2CCCC2)n1.
What is the InChIKey of 5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid?
The InChIKey is LERRHWKEYZHKCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c12-9(13)8-10-7(14-11-8)5-6-3-1-2-4-6/h6H,1-5H2,(H,12,13).
What are the key properties of 5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid?
5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid has a molecular weight of 196.21 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclopentylmethyl)-1,2,4-oxadiazole-3-carboxylic acid is sourced from PubChem (CID 63382576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).