C10H17N3O — CID 114458859
5-(cycloheptylmethyl)-1,2,4-oxadiazol-3-amine (PubChem CID 114458859) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 5-(cycloheptylmethyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(cycloheptylmethyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 114458859 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 5-(cycloheptylmethyl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(CC2CCCCCC2)n1 |
| InChI | InChI=1S/C10H17N3O/c11-10-12-9(14-13-10)7-8-5-3-1-2-4-6-8/h8H,1-7H2,(H2,11,13) |
| InChIKey | MCJRGUKVIJRPMW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |