C14H17N3O — CID 667308
5-(cyclohexylmethyl)-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 667308) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-(cyclohexylmethyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 667308 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 5-(cyclohexylmethyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | c1cc(-c2noc(CC3CCCCC3)n2)ccn1 |
| InChI | InChI=1S/C14H17N3O/c1-2-4-11(5-3-1)10-13-16-14(17-18-13)12-6-8-15-9-7-12/h6-9,11H,1-5,10H2 |
| InChIKey | KDCMKVDAFILOHK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |