C18H20N4O3 — CID 125137803
(5R)-5-[4-[5-(cyclopentylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 125137803) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is (5R)-5-[4-[5-(cyclopentylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[4-[5-(cyclopentylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 125137803 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (5R)-5-[4-[5-(cyclopentylmethyl)-1,2,4-oxadiazol-3-yl]phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccc(-c3noc(CC4CCCC4)n3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C18H20N4O3/c1-18(16(23)20-17(24)21-18)13-8-6-12(7-9-13)15-19-14(25-22-15)10-11-4-2-3-5-11/h6-9,11H,2-5,10H2,1H3,(H2,20,21,23,24)/t18-/m1/s1 |
| InChIKey | XILKKQHNGFTUPO-GOSISDBHSA-N |
| XLogP | 2.52 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|