C22H17N5O4 — CID 154838574
5-methyl-5-[3-[5-[(2-oxo-1H-quinolin-3-yl)methyl]-1,2,4-oxadiazol-3-yl]phenyl]imidazolidine-2,4-dione (PubChem CID 154838574) has the molecular formula C22H17N5O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is 5-methyl-5-[3-[5-[(2-oxo-1H-quinolin-3-yl)methyl]-1,2,4-oxadiazol-3-yl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-[3-[5-[(2-oxo-1H-quinolin-3-yl)methyl]-1,2,4-oxadiazol-3-yl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154838574 |
| Molecular Formula | C22H17N5O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 5-methyl-5-[3-[5-[(2-oxo-1H-quinolin-3-yl)methyl]-1,2,4-oxadiazol-3-yl]phenyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2cccc(-c3noc(Cc4cc5ccccc5[nH]c4=O)n3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C22H17N5O4/c1-22(20(29)25-21(30)26-22)15-7-4-6-13(10-15)18-24-17(31-27-18)11-14-9-12-5-2-3-8-16(12)23-19(14)28/h2-10H,11H2,1H3,(H,23,28)(H2,25,26,29,30) |
| InChIKey | HRBBZHFILLOOTR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|