C21H16N6O4 — CID 154861681
5-methyl-5-[3-[5-(3-methyl-4-oxophthalazin-1-yl)-1,2,4-oxadiazol-3-yl]phenyl]imidazolidine-2,4-dione (PubChem CID 154861681) has the molecular formula C21H16N6O4 and a molecular weight of 416.40 g/mol. Its IUPAC name is 5-methyl-5-[3-[5-(3-methyl-4-oxophthalazin-1-yl)-1,2,4-oxadiazol-3-yl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-[3-[5-(3-methyl-4-oxophthalazin-1-yl)-1,2,4-oxadiazol-3-yl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154861681 |
| Molecular Formula | C21H16N6O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 5-methyl-5-[3-[5-(3-methyl-4-oxophthalazin-1-yl)-1,2,4-oxadiazol-3-yl]phenyl]imidazolidine-2,4-dione |
| SMILES | Cn1nc(-c2nc(-c3cccc(C4(C)NC(=O)NC4=O)c3)no2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H16N6O4/c1-21(19(29)23-20(30)24-21)12-7-5-6-11(10-12)16-22-17(31-26-16)15-13-8-3-4-9-14(13)18(28)27(2)25-15/h3-10H,1-2H3,(H2,23,24,29,30) |
| InChIKey | QEPSFPZSGPMODA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|