C22H20N4O5 — CID 166213750
5-[3-[5-[3-(4-methoxyphenyl)-3-oxopropyl]-1,2,4-oxadiazol-3-yl]phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 166213750) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is 5-[3-[5-[3-(4-methoxyphenyl)-3-oxopropyl]-1,2,4-oxadiazol-3-yl]phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[3-[5-[3-(4-methoxyphenyl)-3-oxopropyl]-1,2,4-oxadiazol-3-yl]phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166213750 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 5-[3-[5-[3-(4-methoxyphenyl)-3-oxopropyl]-1,2,4-oxadiazol-3-yl]phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(C(=O)CCc2nc(-c3cccc(C4(C)NC(=O)NC4=O)c3)no2)cc1 |
| InChI | InChI=1S/C22H20N4O5/c1-22(20(28)24-21(29)25-22)15-5-3-4-14(12-15)19-23-18(31-26-19)11-10-17(27)13-6-8-16(30-2)9-7-13/h3-9,12H,10-11H2,1-2H3,(H2,24,25,28,29) |
| InChIKey | UBADKDGBJQHBFQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|