C22H18N4O3 — CID 154837911
5-[4-[5-(7,8-dihydronaphthalen-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 154837911) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is 5-[4-[5-(7,8-dihydronaphthalen-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[4-[5-(7,8-dihydronaphthalen-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154837911 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 5-[4-[5-(7,8-dihydronaphthalen-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(-c3noc(-c4ccc5c(c4)CCC=C5)n3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C22H18N4O3/c1-22(20(27)24-21(28)25-22)17-10-8-14(9-11-17)18-23-19(29-26-18)16-7-6-13-4-2-3-5-15(13)12-16/h2,4,6-12H,3,5H2,1H3,(H2,24,25,27,28) |
| InChIKey | GMZSNAZIVHNGAK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|