C28H28N4O4 — CID 166182728
1-[[4-(3,4-dihydro-2H-chromen-6-yl)phenyl]methyl]-3-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]urea (PubChem CID 166182728) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 1-[[4-(3,4-dihydro-2H-chromen-6-yl)phenyl]methyl]-3-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]urea.
| Compound Name | 1-[[4-(3,4-dihydro-2H-chromen-6-yl)phenyl]methyl]-3-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 166182728 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 1-[[4-(3,4-dihydro-2H-chromen-6-yl)phenyl]methyl]-3-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]urea |
| SMILES | CC1(c2ccc(CNC(=O)NCc3ccc(-c4ccc5c(c4)CCCO5)cc3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C28H28N4O4/c1-28(25(33)31-27(35)32-28)23-11-6-19(7-12-23)17-30-26(34)29-16-18-4-8-20(9-5-18)21-10-13-24-22(15-21)3-2-14-36-24/h4-13,15H,2-3,14,16-17H2,1H3,(H2,29,30,34)(H2,31,32,33,35) |
| InChIKey | NVTUQQDMMKGNSC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|