C24H20F2N4O3 — CID 166340548
1-[3-(3,4-difluorophenyl)phenyl]-3-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]urea (PubChem CID 166340548) has the molecular formula C24H20F2N4O3 and a molecular weight of 450.45 g/mol. Its IUPAC name is 1-[3-(3,4-difluorophenyl)phenyl]-3-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]urea.
| Compound Name | 1-[3-(3,4-difluorophenyl)phenyl]-3-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 166340548 |
| Molecular Formula | C24H20F2N4O3 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-[3-(3,4-difluorophenyl)phenyl]-3-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]urea |
| SMILES | CC1(c2ccc(CNC(=O)Nc3cccc(-c4ccc(F)c(F)c4)c3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C24H20F2N4O3/c1-24(21(31)29-23(33)30-24)17-8-5-14(6-9-17)13-27-22(32)28-18-4-2-3-15(11-18)16-7-10-19(25)20(26)12-16/h2-12H,13H2,1H3,(H2,27,28,32)(H2,29,30,31,33) |
| InChIKey | VKBHMBCZECLHEI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|