C23H22N6O3 — CID 166208148
1-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-3-[3-(4-methylpyrimidin-2-yl)phenyl]urea (PubChem CID 166208148) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-3-[3-(4-methylpyrimidin-2-yl)phenyl]urea.
| Compound Name | 1-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-3-[3-(4-methylpyrimidin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 166208148 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-3-[3-(4-methylpyrimidin-2-yl)phenyl]urea |
| SMILES | Cc1ccnc(-c2cccc(NC(=O)NCc3cccc(C4(C)NC(=O)NC4=O)c3)c2)n1 |
| InChI | InChI=1S/C23H22N6O3/c1-14-9-10-24-19(26-14)16-6-4-8-18(12-16)27-21(31)25-13-15-5-3-7-17(11-15)23(2)20(30)28-22(32)29-23/h3-12H,13H2,1-2H3,(H2,25,27,31)(H2,28,29,30,32) |
| InChIKey | ITICTAFXWVNZEW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|