C25H19F4N3O3 — CID 166180357
5-fluoro-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 166180357) has the molecular formula C25H19F4N3O3 and a molecular weight of 485.44 g/mol. Its IUPAC name is 5-fluoro-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 5-fluoro-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 166180357 |
| Molecular Formula | C25H19F4N3O3 |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 5-fluoro-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CC1(c2cccc(CNC(=O)c3cc(F)ccc3-c3cccc(C(F)(F)F)c3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C25H19F4N3O3/c1-24(22(34)31-23(35)32-24)16-6-2-4-14(10-16)13-30-21(33)20-12-18(26)8-9-19(20)15-5-3-7-17(11-15)25(27,28)29/h2-12H,13H2,1H3,(H,30,33)(H2,31,32,34,35) |
| InChIKey | AEEBKPUHJLAILL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|