C18H18F4N2O — CID 119429718
5-fluoro-N-[3-(methylamino)propyl]-2-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 119429718) has the molecular formula C18H18F4N2O and a molecular weight of 354.35 g/mol. Its IUPAC name is 5-fluoro-N-[3-(methylamino)propyl]-2-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 5-fluoro-N-[3-(methylamino)propyl]-2-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 119429718 |
| Molecular Formula | C18H18F4N2O |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 5-fluoro-N-[3-(methylamino)propyl]-2-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CNCCCNC(=O)c1cc(F)ccc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F4N2O/c1-23-8-3-9-24-17(25)16-11-14(19)6-7-15(16)12-4-2-5-13(10-12)18(20,21)22/h2,4-7,10-11,23H,3,8-9H2,1H3,(H,24,25) |
| InChIKey | JNFAHQWHVJLRGU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|