C20H19ClF4N2O — CID 120658295
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-fluoro-2-[3-(trifluoromethyl)phenyl]phenyl]methanone;hydrochloride (PubChem CID 120658295) has the molecular formula C20H19ClF4N2O and a molecular weight of 414.83 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-fluoro-2-[3-(trifluoromethyl)phenyl]phenyl]methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-fluoro-2-[3-(trifluoromethyl)phenyl]phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120658295 |
| Molecular Formula | C20H19ClF4N2O |
| Molecular Weight | 414.83 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-fluoro-2-[3-(trifluoromethyl)phenyl]phenyl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1cc(F)ccc1-c1cccc(C(F)(F)F)c1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C20H18F4N2O.ClH/c21-16-4-5-17(12-2-1-3-15(6-12)20(22,23)24)18(7-16)19(27)26-10-13-8-25-9-14(13)11-26;/h1-7,13-14,25H,8-11H2;1H/t13-,14+; |
| InChIKey | YBBSPYGOIXHQEB-KAECKJJSSA-N |
| XLogP | 4.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |