C14H15ClF3N3O3 — CID 120655817
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-nitro-4-(trifluoromethyl)phenyl]methanone;hydrochloride (PubChem CID 120655817) has the molecular formula C14H15ClF3N3O3 and a molecular weight of 365.74 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-nitro-4-(trifluoromethyl)phenyl]methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-nitro-4-(trifluoromethyl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120655817 |
| Molecular Formula | C14H15ClF3N3O3 |
| Molecular Weight | 365.74 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-nitro-4-(trifluoromethyl)phenyl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(C(F)(F)F)cc1[N+](=O)[O-])N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C14H14F3N3O3.ClH/c15-14(16,17)10-1-2-11(12(3-10)20(22)23)13(21)19-6-8-4-18-5-9(8)7-19;/h1-3,8-9,18H,4-7H2;1H/t8-,9+; |
| InChIKey | SICOMLRMCYGCKC-UFIFRZAQSA-N |
| XLogP | 2.33 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.74 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|