C13H15ClIN3O3 — CID 120656643
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-iodo-4-nitrophenyl)methanone;hydrochloride (PubChem CID 120656643) has the molecular formula C13H15ClIN3O3 and a molecular weight of 423.64 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-iodo-4-nitrophenyl)methanone;hydrochloride.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-iodo-4-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120656643 |
| Molecular Formula | C13H15ClIN3O3 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-iodo-4-nitrophenyl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc([N+](=O)[O-])cc1I)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C13H14IN3O3.ClH/c14-12-3-10(17(19)20)1-2-11(12)13(18)16-6-8-4-15-5-9(8)7-16;/h1-3,8-9,15H,4-7H2;1H/t8-,9+; |
| InChIKey | GCPKBVWJKCOWDR-UFIFRZAQSA-N |
| XLogP | 1.91 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|