C15H16ClN3O3S — CID 120658742
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5-nitro-1-benzothiophen-2-yl)methanone;hydrochloride (PubChem CID 120658742) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5-nitro-1-benzothiophen-2-yl)methanone;hydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5-nitro-1-benzothiophen-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120658742 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5-nitro-1-benzothiophen-2-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cc2cc([N+](=O)[O-])ccc2s1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C15H15N3O3S.ClH/c19-15(17-7-10-5-16-6-11(10)8-17)14-4-9-3-12(18(20)21)1-2-13(9)22-14;/h1-4,10-11,16H,5-8H2;1H/t10-,11+; |
| InChIKey | RYUNEKONVXXMBW-NJJJQDLFSA-N |
| XLogP | 2.52 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|