C16H17N3O5S — CID 2336992
ethyl 4-(5-nitro-1-benzothiophene-2-carbonyl)piperazine-1-carboxylate (PubChem CID 2336992) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is ethyl 4-(5-nitro-1-benzothiophene-2-carbonyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(5-nitro-1-benzothiophene-2-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 2336992 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | ethyl 4-(5-nitro-1-benzothiophene-2-carbonyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc3cc([N+](=O)[O-])ccc3s2)CC1 |
| InChI | InChI=1S/C16H17N3O5S/c1-2-24-16(21)18-7-5-17(6-8-18)15(20)14-10-11-9-12(19(22)23)3-4-13(11)25-14/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | BZYYNSOYBBNVCY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|