C14H15N3O3S — CID 119415603
1,4-diazepan-1-yl-(5-nitro-1-benzothiophen-2-yl)methanone (PubChem CID 119415603) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-(5-nitro-1-benzothiophen-2-yl)methanone.
| Compound Name | 1,4-diazepan-1-yl-(5-nitro-1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 119415603 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1,4-diazepan-1-yl-(5-nitro-1-benzothiophen-2-yl)methanone |
| SMILES | O=C(c1cc2cc([N+](=O)[O-])ccc2s1)N1CCCNCC1 |
| InChI | InChI=1S/C14H15N3O3S/c18-14(16-6-1-4-15-5-7-16)13-9-10-8-11(17(19)20)2-3-12(10)21-13/h2-3,8-9,15H,1,4-7H2 |
| InChIKey | PFCWBMMYBRVLLW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|