C15H18N4O3S — CID 119446251
5-nitro-N-(2-piperazin-1-ylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 119446251) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 5-nitro-N-(2-piperazin-1-ylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-nitro-N-(2-piperazin-1-ylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 119446251 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 5-nitro-N-(2-piperazin-1-ylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCN1CCNCC1)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C15H18N4O3S/c20-15(17-5-8-18-6-3-16-4-7-18)14-10-11-9-12(19(21)22)1-2-13(11)23-14/h1-2,9-10,16H,3-8H2,(H,17,20) |
| InChIKey | IADGWQQUIUGUFJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|