C17H13FN2O3S — CID 9402533
N-[2-(4-fluorophenyl)ethyl]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 9402533) has the molecular formula C17H13FN2O3S and a molecular weight of 344.37 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 9402533 |
| Molecular Formula | C17H13FN2O3S |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C17H13FN2O3S/c18-13-3-1-11(2-4-13)7-8-19-17(21)16-10-12-9-14(20(22)23)5-6-15(12)24-16/h1-6,9-10H,7-8H2,(H,19,21) |
| InChIKey | MIONIOGLGJUROI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|