C13H14N2O3S — CID 36710852
N-butyl-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 36710852) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is N-butyl-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-butyl-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 36710852 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-butyl-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C13H14N2O3S/c1-2-3-6-14-13(16)12-8-9-7-10(15(17)18)4-5-11(9)19-12/h4-5,7-8H,2-3,6H2,1H3,(H,14,16) |
| InChIKey | MASJADIGXUDYPR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|