About CID 131866422
CID 131866422 (PubChem CID 131866422) has the molecular formula C9H5NNaO4S
and a molecular weight of 246.20 g/mol.
Molecular Properties
| Compound Name | CID 131866422 |
| PubChem CID | 131866422 |
| Molecular Formula | C9H5NNaO4S |
| Molecular Weight | 246.20 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | — |
| SMILES | O=C(O)c1cc2cc([N+](=O)[O-])ccc2s1.[Na] |
| InChI | InChI=1S/C9H5NO4S.Na/c11-9(12)8-4-5-3-6(10(13)14)1-2-7(5)15-8;/h1-4H,(H,11,12); |
| InChIKey | DUGAPTIANVOIGH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 131866422 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131866422?
The IUPAC name of CID 131866422 (CID 131866422) is not available.
What is the SMILES notation for CID 131866422?
The canonical SMILES for CID 131866422 is O=C(O)c1cc2cc([N+](=O)[O-])ccc2s1.[Na].
What is the InChIKey of CID 131866422?
The InChIKey is DUGAPTIANVOIGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO4S.Na/c11-9(12)8-4-5-3-6(10(13)14)1-2-7(5)15-8;/h1-4H,(H,11,12);.
What are the key properties of CID 131866422?
CID 131866422 has a molecular weight of 246.20 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131866422 is sourced from PubChem (CID 131866422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).