C14H17IN2O2 — CID 120659181
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-iodo-4-methoxyphenyl)methanone (PubChem CID 120659181) has the molecular formula C14H17IN2O2 and a molecular weight of 372.21 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-iodo-4-methoxyphenyl)methanone.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-iodo-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 120659181 |
| Molecular Formula | C14H17IN2O2 |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-iodo-4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2C[C@H]3CNC[C@H]3C2)c(I)c1 |
| InChI | InChI=1S/C14H17IN2O2/c1-19-11-2-3-12(13(15)4-11)14(18)17-7-9-5-16-6-10(9)8-17/h2-4,9-10,16H,5-8H2,1H3/t9-,10+ |
| InChIKey | XFSMJKKFNDUSLJ-AOOOYVTPSA-N |
| XLogP | 1.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|