C14H17IN2O — CID 120657326
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-iodo-5-methylphenyl)methanone (PubChem CID 120657326) has the molecular formula C14H17IN2O and a molecular weight of 356.21 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-iodo-5-methylphenyl)methanone.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-iodo-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 120657326 |
| Molecular Formula | C14H17IN2O |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-iodo-5-methylphenyl)methanone |
| SMILES | Cc1ccc(I)c(C(=O)N2C[C@H]3CNC[C@H]3C2)c1 |
| InChI | InChI=1S/C14H17IN2O/c1-9-2-3-13(15)12(4-9)14(18)17-7-10-5-16-6-11(10)8-17/h2-4,10-11,16H,5-8H2,1H3/t10-,11+ |
| InChIKey | FKCCVTOUUDNPCQ-PHIMTYICSA-N |
| XLogP | 1.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|