C20H21FN2O — CID 120657653
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-4-(4-methylphenyl)phenyl]methanone (PubChem CID 120657653) has the molecular formula C20H21FN2O and a molecular weight of 324.40 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-4-(4-methylphenyl)phenyl]methanone.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-4-(4-methylphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 120657653 |
| Molecular Formula | C20H21FN2O |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-4-(4-methylphenyl)phenyl]methanone |
| SMILES | Cc1ccc(-c2ccc(C(=O)N3C[C@H]4CNC[C@H]4C3)c(F)c2)cc1 |
| InChI | InChI=1S/C20H21FN2O/c1-13-2-4-14(5-3-13)15-6-7-18(19(21)8-15)20(24)23-11-16-9-22-10-17(16)12-23/h2-8,16-17,22H,9-12H2,1H3/t16-,17+ |
| InChIKey | UEHCNGTYSDSWKV-CALCHBBNSA-N |
| XLogP | 3.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |