C15H20INO — CID 172648482
(4,4-dimethylpiperidin-1-yl)-(2-iodo-5-methylphenyl)methanone (PubChem CID 172648482) has the molecular formula C15H20INO and a molecular weight of 357.24 g/mol. Its IUPAC name is (4,4-dimethylpiperidin-1-yl)-(2-iodo-5-methylphenyl)methanone.
| Compound Name | (4,4-dimethylpiperidin-1-yl)-(2-iodo-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 172648482 |
| Molecular Formula | C15H20INO |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | (4,4-dimethylpiperidin-1-yl)-(2-iodo-5-methylphenyl)methanone |
| SMILES | Cc1ccc(I)c(C(=O)N2CCC(C)(C)CC2)c1 |
| InChI | InChI=1S/C15H20INO/c1-11-4-5-13(16)12(10-11)14(18)17-8-6-15(2,3)7-9-17/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | LUEZYKQPZZUPRM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|