C15H22ClIN2O2 — CID 119517181
[4-(1-aminoethyl)piperidin-1-yl]-(2-iodo-4-methoxyphenyl)methanone;hydrochloride (PubChem CID 119517181) has the molecular formula C15H22ClIN2O2 and a molecular weight of 424.71 g/mol. Its IUPAC name is [4-(1-aminoethyl)piperidin-1-yl]-(2-iodo-4-methoxyphenyl)methanone;hydrochloride.
| Compound Name | [4-(1-aminoethyl)piperidin-1-yl]-(2-iodo-4-methoxyphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119517181 |
| Molecular Formula | C15H22ClIN2O2 |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | [4-(1-aminoethyl)piperidin-1-yl]-(2-iodo-4-methoxyphenyl)methanone;hydrochloride |
| SMILES | COc1ccc(C(=O)N2CCC(C(C)N)CC2)c(I)c1.Cl |
| InChI | InChI=1S/C15H21IN2O2.ClH/c1-10(17)11-5-7-18(8-6-11)15(19)13-4-3-12(20-2)9-14(13)16;/h3-4,9-11H,5-8,17H2,1-2H3;1H |
| InChIKey | OECMAEKHYMXUFC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|