C21H28ClN3O2 — CID 119517512
[4-(1-aminoethyl)piperidin-1-yl]-[2-(4-methoxyanilino)phenyl]methanone;hydrochloride (PubChem CID 119517512) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is [4-(1-aminoethyl)piperidin-1-yl]-[2-(4-methoxyanilino)phenyl]methanone;hydrochloride.
| Compound Name | [4-(1-aminoethyl)piperidin-1-yl]-[2-(4-methoxyanilino)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119517512 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | [4-(1-aminoethyl)piperidin-1-yl]-[2-(4-methoxyanilino)phenyl]methanone;hydrochloride |
| SMILES | COc1ccc(Nc2ccccc2C(=O)N2CCC(C(C)N)CC2)cc1.Cl |
| InChI | InChI=1S/C21H27N3O2.ClH/c1-15(22)16-11-13-24(14-12-16)21(25)19-5-3-4-6-20(19)23-17-7-9-18(26-2)10-8-17;/h3-10,15-16,23H,11-14,22H2,1-2H3;1H |
| InChIKey | KUKXBAZRZPXSDY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |